Sodium hydrogen carbonate, also called baking soda, is an active ingredient in some antacids used for the relief of indigestion. Determine the percent of carbon in sodium hydrogen carbonate.

ΔT for the metal = 50.5 °C

ΔT for the water = 4.5 °C

The specific heat capacity for the unknown metal : 0.466 J/g° C  

The law of conservation of energy can be applied to heat changes, i.e. the heat received/absorbed is the same as the heat released  

Q in = Q out  

Heat can be calculated using the formula:  

Q = mc∆T  

Q = heat, J  

m = mass, g  

c = specific heat, joules / g ° C  

∆T = temperature difference, ° C / K  

A 200. g piece of metal is boiled in ethanol (boiling point: 78 C), so :

m metal = 200 g

Ti metal(initial temperature of metal)=78 C

T(system temperature at equilibrium)=27.5

m water = 250 ml x 1 g/ml = 250 g

c water = 4.18 joules / g ° C  

Tiw(initial temperature of water) = 23

\(\tt 78-27.5=50.5^oC\)

\(\tt 27.5-23=4.5^oC\)

\(\tt Q~metal=Q~water\\\\200\times c\times (78-27.5)=250\times 4.18\times (27.5-23)\\\\10100\times c=4702.5\\\\c=0.466~J/g^oC\)

Answer:

Below

Explanation:

This would be a decomposition reaction. This occurs when a compound breaks down into 2 + simpler substances. We can see this from AB --> A + B, one compound (AB) breaks down into 2 simple substances ( A and B ).

Hope that helped!

We are going to look at the picture and try to understand the shape and volume of each state of matter.

The matter has three states: liquid, solid, and gas. Nowadays science considers others. We are going to consider just the three I named.

Shape and Volume:

Gas: has no definite shape. You can look at the picture and see the water steam doesn't have a shape. It's random.

It doesn't have a definite volume either. Molecules from the gas are everywhere.

Liquid: Has a definite volume. Looking at the picture, the glass is open, and molecules are together, they don't escape.

About the shape, take the shape of the container.

Solid: has definite shape and volume.

Answer:

Gas: No definite shape, no definite volume

Liquid: definite volume, take the shape of the container.

Solid: definite volume and shape.

Answer:

B. Be

Explanation:

Answer:

Uracil

Explanation:

The base that will NOT combine with 2-deoxyribose to form a nucleic acid is Uracil.

2-deoxyribose is a pentose sugar found in the DNA (Deoxyribonucleic acid). It is devoid of oxygen in its 2' position. The bases found in DNA are Adenine, Guanine, Cytosine and Thymine. Adenine, Guanine, and Cytosine are also found in RNA (Ribonucleic acid). Thymine is not present in RNA, it is only found in DNA. The base found in RNA is Uracil which in turn is not present in DNA. The five carbon sugar present in RNA is ribose which combines with Uracil.

The result of an increase in temperature at constant pressure will (1) The equilibrium will shift to the left, and the concentration of NO2(g) will decrease.

To determine the effect of an increase in temperature on the given equilibrium reaction, we need to analyze the reaction's heat as well as its stoichiometry.

The given reaction is an endothermic reaction as it absorbs heat (58.1 kJ) on the product side. According to Le Chatelier's principle, an increase in temperature will cause the equilibrium to shift in the direction that absorbs heat, i.e., to the left in this case.

Option 1 states that the equilibrium will shift to the left, which is correct. As the temperature increases, the equilibrium will shift to counteract the increase in heat. This means that more reactants, N₂O₄(g), will be formed, and the concentration of NO₂(g) will decrease.

Option 2 incorrectly suggests that the concentration of NO₂(g) will increase. However, since the equilibrium is shifting to the left, the concentration of NO₂(g) will actually decrease.

Option 3 correctly states that the equilibrium will shift to the right. This is an incorrect answer because an increase in temperature causes the equilibrium to shift in the direction that absorbs heat, which is to the left in this case.

Option 4 incorrectly mentions CO₂(g), which is not present in the given reaction. Therefore, this option is incorrect.

In summary, the correct answer is option 1: The equilibrium will shift to the left, and the concentration of NO₂(g) will decrease when the temperature is increased at constant pressure.
for more such questions on equilibrium

https://brainly.com/question/19340344

#SPJ11

Answer:

uhhhh rephrase that please lol

Answer:430 mg/L = 0.43g/L 

Explanation:

Answer:

Explanation:according to question:

. Nacl (aq) + AgNO3 (aq) --> AgCl

(s) + NaNO3 (aq).balanced.

Taking into account the reaction stoichiometry, if 10.3 g of Ca(OH)₂ reacts, 5.01 grams of H₂O are formed.

The balanced reaction is:

2 H₃PO₄ + 3 Ca(OH)₂  → 6 H₂O + Ca₃(PO₄)₂

By reaction stoichiometry (that is, the relationship between the amount of reagents and products in a chemical reaction), the following amounts of moles of each compound participate in the reaction:

The molar mass of the compounds is:

By reaction stoichiometry, the following mass quantities of each compound participate in the reaction:

The following rule of three can be applied: if by reaction stoichiometry 222 grams of Ca(OH)₂ form 108 grams of H₂O, 10.3 grams of Ca(OH)₂ form how much mass of H₂O?

mass of H₂O= (10.3 grams of Ca(OH)₂ ×108 grams of H₂O)÷ 222 grams of Ca(OH)₂

mass of H₂O= 5.01 grams

Finally, 5.01 grams of H₂O are formed.

Learn more about the reaction stoichiometry:

brainly.com/question/24741074

#SPJ1

Answer:2Al(s) + 3H2SO4(aq) ==> Al2(SO4)3(aq) + 3H2(g)  ...  balanced equation

Using the stoichiometry of the balanced equation (2 mol Al : 3 mol H2SO4) and dimensional analysis, we can find the mass of Al needed to react with 26.5 ml of 0.542 M H2SO4.

Explanation:

Answer:

P-block metals have classic metal characteristics like they are shiny, they are good conductors of heat and electricity, and they lose electrons easily. These metals have high melting points and readily react with nonmetals to form ionic compounds.

Explanation:

Answer:

I don’t mnow

Explanation:

Answer:

Following are the responses to the given choices:

Explanation:

The half-life of a reaction is the time it takes for the concentration of a reactant to decrease to half its initial value. In a first-order reaction, the rate of the reaction is directly proportional to the concentration of the reactant. This means that the rate of the reaction depends on the concentration of compound A.

To calculate the half-life of compound A, you can use the equation:

half-life = (ln(2)) / k

where k is the rate constant for the reaction.

Plugging in the values given in the question, we get:

half-life = (ln(2)) / 0.45

This simplifies to:

half-life = 1.44 / 0.45

Which gives us a final result of:

half-life = 3.2 hours

So the half-life of compound A at 250°C is approximately 3.2 hours.

Learn more about Half-life reactions here: https://brainly.com/question/14228544

The measure of the length of events and the duration of intervals between events is time.

The duration of events or the gaps between them can be measured, compared, or even ordered using time. The lengthy period of time that the Earth's geologic history takes up is known as geologic time. Starting at the beginning of the Archean Eon  formal geologic time runs until the present. Geology is defined as the "Science of the Earth."

Geology is the fundamental Earth science that examines how the earth created, its structure and composition, and the various forces acting on it. It is sometimes known as geoscience or earth science.

Learn more about time  at;

https://brainly.com/question/479532

#SPJ1

The internal energy of a human body is the net energy contained in the body due motion of its particle or molecules.

In a human body the internal energy is stored . It increases when the temperature of the body rises, or when the body observes some changes. Internal energy we can say that is the sum of kinetic and potential energy of all particles in the body.

Internal energy is a state function of a system and is an extensive quantity. Every substance possesses a fixed quantity of energy which depends upon  its chemical nature and also on its state of existence. Every substance have a definite value of Internal energy.

The change in the Internal energy of a reaction may be considered as the difference between the internal energies of the two states.

ΔU = \(E_{B}\) - \(E_{A}\)     where \(E_{B}\) and \(E_{A}\) are the initial energies of states A and B. Or we can also write the equation as:

ΔU = ΔE

To know more about Internal energy

https://brainly.com/question/13125947

#SPJ1

Answer:

Explanation:

If a zero is found between significant digits, it is significant

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

The relationship between the rate of diffusion r, and d is r ∝ 1/√d.

The relationship between the rate of diffusion (r) and the density of a gas (d) can be explained using Graham's law of diffusion. According to this law, the rate of diffusion of a gas is inversely proportional to the square root of its density. Mathematically, it can be expressed as:

r ∝ 1/√d

where the symbol '∝' represents 'proportional to'. The constant of proportionality (k) can be introduced to this equation as:

r = k/√d

This equation shows that as the density of a gas increases, its rate of diffusion decreases. This is because denser gases have more molecules per unit volume and thus, they experience greater intermolecular collisions that hinder their movement. Therefore, it requires more energy for them to diffuse through a medium compared to less dense gases.

The relationship between the rate of diffusion and density is particularly important in understanding the behavior of gases in different environments. For instance, in a gas chromatography column, the rate of diffusion of a gas determines how quickly it moves through the column and separates from other components. Similarly, in the Earth's atmosphere, the rate of diffusion of greenhouse gases such as carbon dioxide affects their concentration and hence, their impact on climate change.

For more such questions on diffusion

https://brainly.com/question/29064792

#SPJ11

The following includes compounds 2 and 4 that are identical. In chemistry, a compound is a substance that is produced when two or more distinct chemical elements are combined in a particular order.

Salts and molecular compounds are the two main categories of chemicals. Covalent bonds are the means through which atoms in molecular compounds are joined. It is connected by ionic bonds in salts. All compounds are composed of these two different sorts of bonds.

(KOM-pownd) A substance in science that is created through the chemical joining of two or more distinct elements Table salt (NaCl), which is a compound comprised of the elements sodium and chloride, and water (H2O), which are examples of compounds.

To know more about  compounds visit:-

https://brainly.com/question/30037191

#SPJ1

Q = Ksp = 1 × 10^(-12).

Substituting the values into the Nernst equation, we have:

0.799 V = E° - (RT/2F) * ln(1 × 10^(-12))

Now, solving for E°:

E° = 0.799 V + (RT/2F) * ln(1 × 10^(-12))

The value of R is the ideal gas constant, T is the temperature in Kelvin, and F is the Faraday constant.

To find the standard reduction potential at 25°C for the half-reaction Ag2CrO4(s) + 2e¯ → 2Ag(s) + CrO4²-(aq), we can use the Nernst equation, which relates the standard reduction potential (E°) to the equilibrium constant (K) and the reaction quotient (Q).

The Nernst equation is given as follows:

E = E° - (RT/nF) * ln(Q)

Given information:

Ksp = 1 × 10^(-12)

E = +0.799 V (standard reduction potential of Ag+ to Ag)

Since the reaction involves the dissolution of Ag2CrO4(s), the reaction quotient Q can be expressed as [Ag+]²/[CrO4²-].

Since the stoichiometry of the reaction is 2:1 for Ag2CrO4 to Ag+, we can say that [Ag+]² = Ksp.

Therefore, Q = Ksp = 1 × 10^(-12).

Substituting the values into the Nernst equation, we have:

0.799 V = E° - (RT/2F) * ln(1 × 10^(-12))

Now, solving for E°:

E° = 0.799 V + (RT/2F) * ln(1 × 10^(-12))

The value of R is the ideal gas constant, T is the temperature in Kelvin, and F is the Faraday constant.

Please note that without specific values for temperature (T) and the ideal gas constant (R), the exact standard reduction potential at 25°C cannot be determined.

For more question on temperature

https://brainly.com/question/4735135

#SPJ8

The machine exerts a force of 9 newtons on the baseball to accelerate it from 0 m/s to 30 m/s in 0.5 seconds.

To calculate the force exerted by the machine on the baseball, we can use Newton's second law of motion, which states that force (F) is equal to the product of mass (m) and acceleration (a).

In this case, the acceleration can be determined using the formula a = (v - u) / t, where v is the final velocity, u is the initial velocity, and t is the time taken for the acceleration.

Given:

Mass of the baseball (m) = 0.15 kg

Initial velocity (u) = 0 m/s (as the baseball starts from rest)

Final velocity (v) = 30 m/s

Time (t) = 0.5 s

First, let's calculate the acceleration:

a = (v - u) / t

a = (30 m/s - 0 m/s) / 0.5 s

a = 60 m/s^2

Now, we can use the calculated acceleration and the given mass to determine the force:

F = m * a

F = 0.15 kg * 60 m/s^2

F = 9 N

The machine exerts a force of 9 newtons on the baseball. This force is calculated using Newton's second law of motion, which states that force is equal to mass multiplied by acceleration.

By determining the acceleration of the baseball using the formula a = (v - u) / t and substituting the given values, we find that the acceleration is 60 m/s^2. Multiplying the mass of the baseball (0.15 kg) by the acceleration gives the force exerted by the machine as 9 newtons.

For more such question on newtons. visit :

https://brainly.com/question/31695057

#SPJ8

The number of moles of nitrogen, N in 65 moles of Pb(NO₃)₄ is 260 moles

We'll begin by obtaining the number of mole of N in one mole of Pb(NO₃)₄. Details below:

From the formula of Pb(NO₃)₄, we can see that there are 4 moles of N in 1 mole of Pb(NO₃)₄

With the above information, we can determine the number of mole of N in 65 moles of Pb(NO₃)₄. This is illustrated below:

1 mole of Pb(NO₃)₄ contains 4 moles of N

Therefore,

65 mole of Pb(NO₃)₄ will contain = (65 moles × 4 moles) / 1 mole = 260 moles of N

Thus, we can conclude from the above calculation that the number of mole of N is 260 moles

Learn more about mole:

https://brainly.com/question/13314627

#SPJ1

The common logarithm by exponentiating all sides with base 10 we obtain [H+] = 10pH. In a solution with a pH near 2, the pOH is 12, the hydrogen ion concentration is 10-2 M, and the hydroxide ion concentration is 10-2 M.

The negative logarithm of the hydrogen ion concentration is used to calculate the pH of a solution. Change the hydrogen ion's value in the equation above. Hence, the pH of [10 - 8] 6.98 M HCl solution.

A solution with such a concentration of hydroxyl ions of 1012 M has a pH of 2. As the pOH is indeed the numerical expression of the OH- ion concentration, such a solution does have a pOH of 12. As the sum of the pH & pOH must equal 14, the pH must be 2.

To know more about hydroxide visit:

https://brainly.com/question/4251554

#SPJ1

Answer:

Claim: The chemical equation presented in the data table does NOT follow the law of conservation of matter

Evidence: Since we initially have 14.25 grams of Na and 9.5 grams of HCl

we will find the number of moles in each, to further apply stoichiometry

So,

Moles of Na: Given mass/Molar Mass = 14.25/23 = 0.62 Moles of Na

Moles of HCl: Given mass/Molar Mass = 9.5/36.5 = 0.26 Moles of HCl

Since HCl is the limiting reagent in this reaction,

0.26 Moles of Na will be consumed, which is equal to

5.98 grams of Na

Reasoning:

We are given that the total mass of the product is 22.98 grams

but through stoichiometry, we have found that only (9.5 + 5.98) = 15.48 grams of product can possibly be formed

Hence, the reaction presented in the table does NOT follow the law of conservation of matter

The ionic equations of the given reactions are as follows:

Ionic equations are equations which shows the ions involved in a given redox reaction as they react to form products.

The ionic equations of the given reactions are as follows:

a) precipitation of iron(III) hydroxide when solutions of sodium hydroxide and iron(III) nitrate are mixed

Molecular equation: NaOH + Fe(NO₃)₃ → Fe(OH)₃(s) + NaNO₃

Ionic equation: Na⁺ OH⁻ + Fe³⁺ 3NO₃⁻ →  Fe(OH)₃(s) + 3Na⁺ 3NO₃⁻

b) redox reaction between solution of silver(1) nitrate and magnesium metal

Molecular equation: 2 AgNO₃ + Mg → Mg(NO₃)₂ + 2 Ag (s)

Ionic equation: 2Ag⁺ 2NO₃⁻ + Mg → Mg²⁺ 2NO⁻ + 2 Ag (s)

c) acid-base reaction between sulfuric acid and potassium hydroxide

Molecular equation: H₂SO₄ + 2KOH → K₂SO₄ + 2H₂O

Ionic equation: 2H⁺ SO₄²⁻ + 2K⁺ 2OH⁻ → 2K⁺ SO₄²⁻ + 2H₂O (l)

Learn more about ionic equations at: https://brainly.com/question/13879496

#SPJ1