Suppose a soap manufacturer starts with a triglyceride that has the fatty acid chains arachidic acid, palmitic acid and palmitic acid attached to the three backbone carbons. The manufacturer saponifies the triglyceride with NaOH. What are the fatty acid soaps that are produced in the process

The partial pressure of nitrogen on Venus is approximately 321.914 kPa.

To find the partial pressure of nitrogen on Venus, we need to calculate the partial pressure using the mole fraction of nitrogen and the total atmospheric pressure. First, we convert the total atmospheric pressure from psi to kilopascals (kPa) since the mole fraction is given in terms of kPa.

1 psi = 6.89476 kPa

Therefore, the total atmospheric pressure on Venus is:

1334 psi × 6.89476 kPa/psi = 9197.53 kPa

Next, we can calculate the partial pressure of nitrogen using the mole fraction. The mole fraction of nitrogen is given as 0.035, which means that nitrogen makes up 3.5% of the total moles of gas in the atmosphere.

The partial pressure of nitrogen is given by:

Partial pressure of nitrogen = Mole fraction of nitrogen × Total atmospheric pressure

Partial pressure of nitrogen = 0.035 × 9197.53 kPa

Partial pressure of nitrogen = 321.914 kPa

Therefore, the partial pressure of nitrogen on Venus is approximately 321.914 kPa.

It's important to note that the given atmospheric composition of Venus's atmosphere and the total atmospheric pressure are approximate values and can vary depending on specific conditions and measurements.

For more such question on partial pressure visit:

https://brainly.com/question/19813237

#SPJ8

Answer:

See below.

Explanation:

The atomic number of lead (Pb) is 82, which means it has 82 electrons. The electronic configuration of lead is

1s² 2s² 2p⁶ 3s² 3p⁶ 3d¹⁰ 4s² 4p⁶ 4d¹⁰ 5s² 5p⁶ 4f¹⁴ 5d¹⁰ 6s² 6p²

The orbital diagram for the valence electrons of lead (Pb) is

↑↓ ↑↓ ↑↓ ↑↓ ↑↓ ↑↓ ↑↓ ↑↓

s s p p p p d d

2 1 6 2 6 2 10 10

|||||||||

1 2 3 4 5 6 7 8

The notation ↑↓ represents a pair of electrons with opposite spins.

To determine if lead (Pb) is diamagnetic or paramagnetic, we need to look at whether there are any unpaired electrons. Based on the orbital diagram, we can see that all the electrons in the valence shell are paired, meaning that lead (Pb) is diamagnetic.

The mass of water is 1.89g

Mass is a measure of the amount of matter that an object contains

Here given data is 1.23 g of butane reacts with excess oxygen and the reaction is

C₄H₁₀ + 13/2 O₂ →4CO₂ + 5H₂O

Mole of butane = 1.23/58.12g/mol⁻¹

Mole of butane = 0.021mol

We assume complete combustion, and know that each mole of butane gives off 5 mol of water upon combustion.

We know the molar quantity of butane then

5×0.021×18.01 = 1.89g

Mass of water is 1.89g

Know more about mass

https://brainly.com/question/11257617

#SPJ1

Answer:

15

Explanation:

the proton and atomic number are the same hence it remains 15

The maximum mass of hydrogen sulfide that can form is 17.01 g.

What is Limiting Reagent?

A limiting reagent, also known as a limiting reactant, is the substance that is completely used up in a chemical reaction and limits the amount of product that can be formed. It is the reactant that is present in the smallest stoichiometric amount and, as a result, determines the theoretical yield of the reaction. The other reactants may be present in excess and may not be completely used up.

To determine which reactant is the limiting reagent, we need to calculate the amount of product that each reactant would produce and see which one produces less.

The balanced chemical equation for the reaction between aluminum sulfide and water is:

First, we need to calculate the amount of moles of each reactant:

moles of Al2S3 = mass ÷ molar mass = 25.00 g ÷ 150.16 g/mol = 0.1664 mol

moles of H2O = mass ÷ molar mass = 50.00 g ÷ 18.02 g/mol = 2.776 mol

Next, we need to determine the limiting reagent. From the balanced equation, we can see that one mole of Al2S3 reacts with 6 moles of H2O. Therefore, the amount of H2O required to react with 0.1664 mol of Al2S3 is:

0.1664 mol Al2S3 × 6 mol H2O/mol Al2S3 = 0.9984 mol H2O

Since we have 2.776 mol of H2O available, we have more than enough water to react with the 0.1664 mol of Al2S3. This means that aluminum sulfide is the limiting reagent.

To calculate the maximum mass of hydrogen sulfide that can form, we need to use the amount of moles of Al2S3 as the basis of our calculation. From the balanced equation, we know that 1 mole of Al2S3 produces 3 moles of H2S. Therefore:

moles of H2S = moles of Al2S3 × 3 mol H2S/mol Al2S3 = 0.1664 mol × 3 mol H2S/mol Al2S3 = 0.4992 mol H2S

Finally, we can calculate the mass of hydrogen sulfide produced using its molar mass:

mass of H2S = moles of H2S × molar mass = 0.4992 mol × 34.08 g/mol = 17.01 g

Therefore, the maximum mass of hydrogen sulfide that can form is 17.01 g.

Learn more about Limiting Reagent from given link

https://brainly.com/question/30628347

#SPJ1

So,

Dry ice is a compound consisting of one carbon dioxide molecule chemically bonded to two molecules of oxygen. This compound is the solid form of carbon dioxid.

This is a photo of this compound:

It is a compound since it is formed by more than one element. (CO2)

ANSWER

The mole of NH4Cl is 0.0512 mole

STEP-BY-STEP EXPLANATION:

Given parameters

Mass of NH4Cl = 2.73g

The next thing is to find the molar mass of NH4Cl

Given the molar mass of each element

• N = 14 g/mol

• H = 1 g/mol

• Cl = 35.5 g/mol

NH4Cl = 14 + (4 x 1) + 35.5

NH4Cl = 14 + 4 + 35.5

NH4Cl = 53.3 g/mol

The formula for calculating mole is written below

Hence, the mole of NH4Cl is 0.0512 mole

Answer:

C2H2

Explanation:

Mass of Carbon in CO2\(= (12/44) (20.31)\) grams \(= 5.54\) gram

Mass of hydrogen in H2O \(= (2/18)(4.26)\) grams \(= 0.46\) gram

We will calculate the % of C and H in the sample  

% C \(= (5.54/6) * 100 = 92\)%

% H \(= (0.46/6)*100 = 7.7\)%

Number of mole of C \(= 92/12 = 7.69\)

Number of mole of H \(= 7.67/1 = 7.67\)

Fractional share of  C \(= 7.69/7.67 = 1\)

Fractional share of  H \(= 7.67/7.67 = 1\)

Empirical Formula = CH

Empirical Mass \(= 12+1 = 13\)

Molecular mass \(= 26\)

Molecular Formula – CHn  

N \(= 26/13 = 2\)

Molecular Formula = C2H2

The mass of the percent of the 10 g solute in the 105 g solvent is 8.69 %.

The mass of the solute = 10 g

The mass of the solvent = 105 g

The mass of the solution = 10 g + 105 g

The mass of the solution = 115 g

The mass of the percent is expressed as :

The mass of percent = ( mass of solute / mass of solution ) × 100 %

The mass of solute = 10 g

The mass of solution = 115 g

The mass of percent = ( 10 / 115 ) × 100 %

The mass of percent = 8.69 %

Thus, the mass of percent is 8.69 % and the mass of solute is 10 and the mass of the solution is 115 g.

To learn more about mass of percent here

https://brainly.com/question/30742204

#SPJ1

Answer:

1866.4 secs

Explanation:

The integrated rate law for first order kinetics is given by;

[A] = [Ao] ^-kt

Where;

[A] = concentration of cyclopropane at time = t

[Ao] = initial concentration of cyclopropane

k = rate constant

t = time taken

From the question, we are told that 99% of cyclopropane disappeared hence;

[A] = 0.290 - (0.99 * 0.290)

[A] = 0.290 - 0.2871

[A] = 0.0029 M

Hence

0.0029 = 0.290 e^-2.74 x 10^ - 3 * t

0.0029/0.290 = e^-2.74 x 10^ - 3 * t

0.01 = e^-2.74 x 10^ - 3 * t

ln(0.01) = -2.74 x 10^ - 3 * t

-4.61 = -2.74 x 10^ - 3 * t

t= -4.61/-2.74 x 10^ - 3

t = 1866.4 secs

The concentration of sodium ions in 0.130 M Na₂HPO₄  is 0.26 M.

The Na₂HPO₄ will dissociates in to ions we get :

Na₂HPO₄  ---->  2Na⁺   +  HPO₄⁻

here from the above equation it is clear that,the  1 moles of Na₂HPO₄ produce the 2 moles of Na⁺  and 1 mole of Na₂HPO₄  will produce 1 mole of  HPO₄⁻.

the concentration of Na⁺ = ?

concentration of the Na⁺ = 2 × Na₂HPO₄

concentration of the Na⁺ = 2 × 0.130 M

the concentration of the Na⁺ = 0.26 M    

Thus,  The concentration of sodium ions in 0.130 M Na₂HPO₄  is 0.26 M.

To learn more moles here

https://brainly.com/question/21323029

#SPJ9

The physical examination of an organic compound are appearance and physical state, melting point and boiling point, solubility, density, and spectroscopic analysis

Appearance and physical state: observe the appearance of the compound and note its physical state.

Melting point and boiling point: measure the melting point and boiling point of the compound to determine its purity and identity.

Solubility: Test the solubility of the compound in different solvents such as water, ethanol, acetone, etc.

Density: determine the density of the compound to calculate its molecular weight and to assess its purity.

Spectroscopic analysis: use spectroscopic techniques such as nuclear magnetic resonance (NMR), and mass spectrometry (MS) to determine the functional groups, molecular structure, and identity of the compound.

Learn more about organic compound here: https://brainly.com/question/5994723

#SPJ1

The value of 0.134 M was found to correspond to the concentration of the solution.

Titration is a technique of analysis that, as far as we are aware, relies on the volume of the solutions in order to determine the concentration of the substance being tested.

We are aware of that;

Vinegar's total volume is equal to 5 ml plus 25 ml, which equals 30 ml.

0.1098 millimolar is the concentration of sodium hydroxide.

The volume of sodium hydroxide that was utilized was calculated to be 36.48 mL by subtracting 1.35 mL from 37.83 mL.

Applying the calculation method;

CAVA/CVB = NA/VB

CBVBNA is equal to CAVANB.

CA= CBVBNA/VANB

CA = 0.1098 * 36.48 * 1/30 * 1

CA = 0.134 M

Learn more about concentration

at https://brainly.com/question/10725862

#SPJ1

Answer:

the answer that best describe the two methods is c

Answer:

Matter has different densities. Different food colorings have different densities. Those with a higher density will sink to the bottom and mix much easier than one with a lower density. The higher density also contains more particles making it easier to mix or give it a fuller color.

Evaporation causes the dew to vanish when the temperature of the atmosphere rises with the rising of the sun.

A kind of vaporization called evaporation takes place on the surface of a liquid as it transitions into the gas phase. When humidity impacts the rate of evaporation of water, for example, a high concentration of the evaporating material in the surrounding gas considerably slows down evaporation.

Similar to how perspiration evaporates from your body on a hot day to cool you down, dew evaporates as it cools the plant. This lessens heat exhaustion in extremely hot settings. Some species, particularly desert plants, are capable of directly absorbing water via their leaves.

Thus, Evaporation causes the dew to vanish when the temperature of the atmosphere rises with the rising of the sun.

To learn more about evaporation, follow the link;

https://brainly.com/question/5019199

#SPJ1

Answer:

V=mass/Density

Explanation:

Since density is measured as grams/mL or grams/cm^3 and we are interested in converting mass to volume, we need to rewrite the equation.
Therefore, in order to convert the gram to mL, you just need to multiply the mass of the substance in grams with its density to get the volume in liters.

Answer:

Volume equals mass divided by density.

and

Mass equals density times volume.

Hope this helps :)

Pls brainliest...

Answer:

93.4 mL

Explanation:

Let's state the reaction:

2AgNO₃ +  Na₂CO₃  →   Ag₂CO₃  +  2NaNO₃

We determine the moles of sodium carbonate:

0.3572 g . 1mol / 105.98g = 3.37×10⁻³ moles

Ratio is 1:2. We say:

1 mol of sodium carbonate react to 2 moles of silver nitrate

Then, our 3.37×10⁻³ moles of carbonate may react to: 3.37×10⁻³ . 2

= 6.74×10⁻³ moles

If we convert to mmoles → 6.74×10⁻³ mol . 1000 mmol / mol = 6.74 mmol

Molarity is mol/L but we can use mmol /mL

6.74 mol / volume in mL = 0.07216 M

6.74 mol / 0.07216 M = volume in mL → 93.4 mL

Answer:

Top question is B

Bottom question is A

Explanation:

Answer:

top answer : B. intrusive igneous rock

bottom answer : A. extrusive igneous rock

Hope this helps!

Please rate my anser and say thanks!

Answer:

216.0cm³ of ore must be processed

Explanation:

First, we need to know how many grams of gold we need to obtain $100.00

Mass of gold to obtain $100.00:

$100.00 gold * (1 troy oz / $818) = 0.122 troy oz

0.122 troy oz * (1.0lb / 14.6troy oz) = 8.37x10⁻³ lb

8.37x10⁻³ lb * (454g / 1lb) =

3.80g of gold we need to obtain $100.00

Now, the ore contain 0.22g of gold in 100g and the density of the ore is 8.0g/cm³. We can solve the cubic centimeters to obtain $100.00:

Cubic centimeters of ore:

3.80g Gold * (100g Ore / 0.22g Gold) = 1727.9g of Ore

1727.9g Ore * (1cm³ / 8.0g Ore) =

Answer: 190.9K

Explanation:

5.6(14) = 5(.0821)T  or  (5.6*14)/(5(.0821))

78.4 = 0.4105T

190.9K = T

The weight of 5.6 L of chlorine gas Cl₂ at NTP is 17.75 grams

The volume of a gas at normal temperature and pressure, NTP, is given as

22.4 L = 1 mole of a gas

With the above information, we can obtain the weight (in grams) of the 5.6 L of chlorine gas Cl₂. This is shown below.

The following data were obtained from the question:

At normal temperature and pressure, NTP, the volume of chlorine gas is given as follow:

22.4 L = 1 mole of chlorine gas, Cl₂

22.4 L = 71 grams of chlorine gas, Cl₂

Therefore,

5.6 L = (5.6 L × 71 grams) / 22.4 L

5.6 L = 17.75 grams of chlorine gas, Cl₂

Thus, we can conclude from the above calculation that the weight of the gas at NTP is 17.75 grams

Learn more about weight of gas:

https://brainly.com/question/28724214

#SPJ1

Cytokines serve as chemical signals between cells and stimulate a wide range of nonspecific defenses.

Cytokines are the proteins which act as soluble mediators and as messengers secreted by one cell to alter its own behavior or that of another cell. They are the regulators of immune responses, working within the immune system and between the immune system and other complex cellular networks within other tissues in the body. This serves the  physical nonspecific defenses of innate immunity include physical barriers, mechanical actions that remove microbes and debris and the microbiome which competes with and inhibits the growth of pathogens. The skin, mucous membranes, and endothelia throughout the body serve as physical barriers.

To learn more about Cytokines please visit:

https://brainly.com/question/314066

#SPJ4

Answer:

A. A Lewis acid accepts an electron pair from a base

Explanation:

PLATO

The definition of a Lewis acid is that a Lewis acid accepts an electron pair from a base.

According to the Arrhenius concept, base is defined as a substance which yields hydroxyl ions on dissociation.These ions react with the hydrogen ions of acids to produce salt in an acid-base reaction.

Bases have a pH higher than seven as they yield hydroxyl ions on dissociation.They are soapy in touch and have a bitter taste.According to the Lowry-Bronsted concept, base is defined as a substance which accepts protons .Base react violently with acids to produce salts .Aqueous solutions of bases can be used to conduct electricity .They can also be used as indicators in acid-base titrations.

They are used in the manufacture of soaps,paper, bleaching powder.Calcium hydroxide ,a base is used to clean sulfur dioxide gas while magnesium hydroxide can be used as an antacid to cure acidity.

Learn more about base,here:

https://brainly.com/question/12445440

#SPJ7

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

2.25 atm

Explanation:

Given data

Step 1: Convert the pressure of nitrogen to atm

We will use the relationship 1 atm = 101.325 kPa.

\(321kPa \times \frac{1atm}{101.325kPa} = 3.17 atm\)

Step 2: Convert the pressure of oxygen to atm

We will use the relationship 1 atm = 14.6959 psi.

\(74.0psi \times \frac{1atm}{14.6959psi} =5.04atm\)

Step 3: Calculate the partial pressure of hydrogen

The total pressure is the sum of the partial pressures.

P = pN₂ + pO₂ + pH₂

pH₂ = P - pN₂ - pO₂

pH₂ = 10.46 atm - 3.17 atm - 5.04 atm

pH₂ = 2.25 atm

Answer:

\(P_H=2.25atm\)

Explanation:

Hello,

IN this case, we can apply the Dalton's law in order to understand the pressure behavior of a mixture as the summation of all the pressures of the compounds in the mixture, in this case, nitrogen, oxygen and hydrogen:

\(P_T=P_O+P_N+P_H\)

So, since we are asked to compute the pressure of hydrogen, we simply solve for it:

\(P_H=P_T-P_O-P_N=10.46atm-74.0psi*\frac{1atm}{14.6959psi} -321kPa*\frac{1atm}{101.325kPa} \\\\P_H=2.25atm\)

Best regards.

Answer:

HI is a diatomic molecular compound known as hydrogen iodide or hydroiodic acid. It is a strong acid.

Answer:

The answer to this reaction would be C-C-OH + H2.

Answer:

Energy in the United States comes mostly from fossil fuels: in 2010, data showed that 25% of the nation's energy originates from petroleum, 22% from coal, and 22% from natural gas.

Explanation:

It is really self explanitory