what is the empirical formula for a compound that is 40% S, and 59.9% O?​

The concept molarity is an important method which is used to calculate the concentration of a solution. The term molarity is also called the molar concentration. Here the molarity of CaCl₂ solution is 3.58 M.

The term molarity is defined as the number of moles of the solute present per liter of the solution. It is an important method which is employed to find out the concentration of a binary solution. It is indicated as 'M'.

Molarity = Number of moles / Volume of solution in liters

n = Mass / Molar mass

n = 812 / 110.98 = 7.31

M = 7.31 / 2.04 = 3.58 M

To know more about Molarity, visit;

https://brainly.com/question/16727614

#SPJ1

The volume of the liquid = 8.7 ml

Graduated cylinder is a laboratory tool used to measure the volume of liquid

Also called a measuring cylinder

Each line (marked line) on this cylinder shows a scale that shows the total volume of water.

The reading is based on a curve of the fluid formed called the meniscus. Read the measurement of the amount of fluid at the bottom of the meniscus (the position of our eyes is parallel to the level of the meniscus and the cylinder is located in a flat (not tilted) place

If we look at the picture (attached), the meniscus is located between the scale / line 8.6 and 8.8(interval 0.2 ml), so the volume of the liquid shows the number 8.7 ml

Answers answer questions and

Answer:

Ka = 6.02x10⁻⁶

Explanation:

The equilibrium that takes place is:

We calculate [H⁺] from the pH:

Keep in mind that [H⁺]=[A⁻].

As for [HA], we know the acid is 0.66% dissociated, in other words:

We calculate [HA]:

Finally we calculate the Ka:

Answer:

A physical change is a change in form.

A Chemical change is a change in materials.

Explanation:

Example of a physical change would be an ice cube meting.

Example of a chemical change would be mixing food coloring into a cup of water.

Answer:

D

Explanation:

The ratio of C6H12O6 (which will be referred to as "the carb") to oxygen is 1 to 6, so if we find an answer which has the same ratio, it should be chosen. A is 1:3
B is even worse with a ratio of the carb to oxygen of 1:2
C is the same as B, 1:2
D has a ratio of the carb to oxygen of 1:6, which is what we are looking for.

(a) Because acid is caustic, dolphins can perish from exposure to it. Acids are compounds that give other things protons (H+). Acid can react with the proteins and lipids in dolphins' skin when they come into touch with it, leading to chemical burns and damage to the underlying tissue. Systemic consequences from this include death.

(b) Because chlorine is a potent oxidizer, it interacts with red-hot iron powder to produce Iron(III) chloride (FeCl3) rather than Iron(II) chloride (FeCl2). FeCl3 is created when chlorine at high temperatures rapidly accepts electrons from iron atoms. Contrarily, iron interacts with HCl, a less potent oxidizer than chlorine, to produce FeCl2.

Learn more about chlorine at :

https://brainly.com/question/31560014

#SPJ1

Kc = [H3O+][HCO3-] / [H2CO3]

Remember that Kc is products over reactants. Also, you do not include liquid water in a Kc expression, since liquid water has no concentration.

Hydrogen bonding, which is unquestionably what we have, will occur from the intermolecular force between the molecules of H2O and CH3OH. Atoms trade or exchange valence electrons to create bonds.

Trust and self-esteem are developed in children and adolescents through strong emotional ties. After that, they can leave the family and establish wholesome friendships and other types of social ties. Healthy relationships consequently lower a child's chances of emotional discomfort or antisocial behaviour.

The government of a country issues government bonds, a sort of fixed-interest bond. These bonds are thought of as low-risk investments. Examples of different kinds of government bonds include T - bills, Municipality Bond, Zero-Coupon Bonds, and others.

To know more about intermolecular visit:

https://brainly.com/question/9007693

#SPJ1

Answer:

3.7L

Explanation:

Given parameters:

Initial volume  = 5.6L

Initial temperature  = 25°C = 273 + 25 = 298K

Final temperature = -78°C = 273 + (-78) = 195K

Unknown:

New volume of the balloon = ?

Solution:

We are going to assume that the pressure is constant and then we apply the charles's law;

  "the volume of fixed mass of a gas varies directly as its absolute temperature if its pressure is constant"

 mathematically;

         \(\frac{V_{1} }{T_{1} }\)   = \(\frac{V_{2} }{T_{2} }\)

Where V and T are temperature

            1 and 2 are initial and final states

Insert the parameters and solve;

       \(\frac{5.6}{298}\)  = \(\frac{V_{2} }{195}\)

      298V₂  = 1092

              V₂  = 3.7L

According to the electronic configuration as the atomic size increases down the group, the melting point decreases .

Electronic configuration is defined as the distribution of electrons which are present in an atom or molecule in atomic or molecular orbitals.It describes how each electron moves independently in an orbital.

Knowledge of electronic configuration is necessary for understanding the structure of periodic table.It helps in understanding the chemical properties of elements.

Elements undergo chemical reactions in order to achieve stability. Main group elements obey the octet rule in their electronic configuration while the transition elements follow the 18 electron rule. Noble elements have valence shell complete in ground state and hence are said to be stable.

Learn more about electronic configuration,here:

https://brainly.com/question/29757010

#SPJ2

Answer:

This is because tap water contains chloride ions which will give a precipitate of AgCl with AgNO3 solution even if the organic compound does not contain chlorine.

Biotechnology is the use of living organisms or other biological systems in the manufacture of drugs or other products or for environmental management, as in waste recycling: includes the use of bioreactors in manufacturing, microorganisms to degrade oil slicks or organic waste, genetically engineered bacteria to produce human hormones, and monoclonal antibodies to identify antigens.

Biotech offers the possibility of improving human health, the environment, and agriculture while creating more sustainable modes of production.

Answer:B. Burning toast is a chemical change; straining orange juice is a physical change.

Explanation:

A Physical change Is a type of change on a substance that does not affect its composition but can only change the appearance of the substance.

While

A  Chemical changes is one that changes the substance to  an entirely new substance.

Now 1.  Burning toast is a chemical change, This is because First, Burning is a chemical reaction on its own . The toast also is a different substance from the white bread itself to a brown substance .

2. Straining orange juice is a physical change because no new substance is being formed only a SEPARATION of the orange pulp from the juice.

See related answer here:   https://brainly.in/question/12042978

We have that Burning toast is a chemical change; straining orange juice is a physical change.

The correct option is Option B

Physical change

This Refers to a change to the Physical Characteristics of a substance

While

Chemical change is a change Chemical Characteristics of a substance

and

Physical changes tends to undergo reversible processes while

chemicals do not

Therefore

The correct option is Option B

Burning toast is a chemical change; straining orange juice is a physical change.

For more information on this visit

https://brainly.com/question/17756498?referrer=searchResults

1) List the known quantities

Initial conditions

Concentration 1: 1.6 M

Volume 1: 175 mL

Final conditions

Volume 2: 1 L

Concentration 2: unknown

2) Set the equation

3) Convert units

Volume

1 L = 1000 mL

4) Plug in the known quantities and solve for C2

The new concentration is 0.28 M.

.

The word "symptom" refers to a specific manifestation or indication of a condition, disease, or disorder that is experienced or observed by an individual.

Symptoms are subjective or objective changes in the body's normal functioning that may be recognized as abnormal, uncomfortable, or problematic. Symptoms can manifest in various ways depending on the nature of the underlying condition. They can be physical, such as pain, rash, cough, fever, or fatigue, indicating an illness or injury affecting the body. Symptoms can also be psychological, such as anxiety, depression, or confusion, reflecting disturbances in mental health.

Symptoms serve as important clues for medical professionals to identify and diagnose diseases or disorders. They provide valuable information about the nature, severity, and progression of an illness, helping healthcare providers formulate appropriate treatment plans. Additionally, symptoms may also be important for individuals to self-assess their own health status and seek appropriate medical attention.

It is essential to note that symptoms alone may not provide a definitive diagnosis, as they can overlap across different conditions. Further evaluation, including medical tests and examinations, is often necessary to confirm a diagnosis and determine the appropriate course of action.

for more such questions on symptom

https://brainly.com/question/21078887

#SPJ8

Answer:

The more easily these cations form, the more reactive the metal.

Explanation:

Answer:

this is of effective nuclear charge.

Answer: 0.00098

Explanation:

1. Zeroes that appear before a nonzero significant figure are not significant.

  Ex: 0.002 (1 significant figures), 0.13 (2 significant figures)

2. Zeroes that appear between nonzero digits are significant

  Ex: 0.705 (3 significant figures), 2006 (4 significant figures)

3. Zeroes that appear after a nonzero digit are significant only if it is

A. Followed by a decimal point

  Ex: 40 (1 significant figure), 20. (2 significant figures)

or B. They appear to the right of a decimal point

  Ex: 37.0 (3 significant figures), 4.100 (4 significant figures)

There are \(3.97*10^2^4\) particles in 6.2 moles of aluminum.

Given:

moles of aluminium = 6.2

Particle number = moles * Avagadros number

No of particles = \(6.2*6.02*10^2^3\\\)

No of particles = \(3.97 * 10^2^4\)

How do you calculate particles?

A number of particles = Avogadro constant the volume of the substance in mol is a formula for calculating the number of particles in a substance.

What is 1 mole?

A mole is the volume of a substance that contains 6.022 X 1023 of the substance's particles, atoms, ions, molecules, etc.A mole is a measurement unit for counting atoms, molecules, or ions.

Can your particles be equal to 1 mole?

1 mole = 6.022 × 10^23 particles.

To know more about 1 mole:

https://brainly.com/question/30337257

#SPJ1

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

1

Explanation:

To determine the value of K (equilibrium constant) at 25 °C, we can use the Nernst equation, which relates the cell potential (E) to the equilibrium constant (K) and the standard cell potential (EºCell). The Nernst equation is given by:

E = EºCell - (RT / nF) * ln(K)

Where:

E = cell potential

EºCell = standard cell potential

R = gas constant (8.314 J/(mol·K))

T = temperature in Kelvin (25 °C = 298 K)

n = number of electrons transferred in the balanced redox equation

F = Faraday's constant (96,485 C/mol)

ln = natural logarithm

In this case, the given standard cell potential (EºCell) is -0.37 V.

The balanced redox equation for the cell reaction is:

Pt + Cr²+ -> Pt + Cr³+

Since there is no change in the oxidation state of Pt, no electrons are transferred in the reaction (n = 0).

Substituting the known values into the Nernst equation, we have:

E = -0.37 V - (8.314 J/(mol·K) * 298 K / (0 * 96,485 C/mol)) * ln(K)

E = -0.37 V

Since n = 0, the term (RT / nF) * ln(K) becomes 0, and we are left with:

-0.37 V = -0.37 V - 0

This implies that the value of K is 1, since any number raised to the power of 0 is equal to 1.

Therefore, the value of K at 25 °C for the given cell is 1.

A muffi n recipe calls for cream of tartar, or potassium hydrogen tartrate. The amount of cream of tartar that is required contains 2.56 ×10²³atoms of carbon. 0.42moles of potassium hydrogen tartrate is required

In the Global System of Units (SI), the mole represents the unit of material quantity. How many fundamental entities of a particular substance are present within an object a sample is determined by the quantity of that material. An elementary entity can be a single atom, a molecular structure, an ion, a charged particle pair, or a particle that is subatomic like a proton depending on the makeup of the substance.

For instance, despite the fact that the two substances have different volumes and masses, 10 moles of water because 10 moles of the chemical element mercury both contain the same quantity of stuff, because the mercury comprises exactly one particle for each molecule of water.

mole = 2.56 ×10²³/ 6.022×10²³

       = 0.42moles

To know more about mole, here:

https://brainly.com/question/26416088

#SPJ1

Answer:

Potential energy of an object is found in its position, not its motion.

Explanation:

Brainliest if this helped please!

Answer:

No that Kinetic Energy.

Explanation:

Potential Energy means it's at its highest point and its not moving so its storing up that energy. Kinetic Energy is when the object is using that energy so its using the Potential energy and turning into Kinetic Energy.

Brainliest Please if you likes the answer.

Answer:

the answer is B:

Explanation:

I hope it help.

160 Grams are present in 1.200 moles of (NH₄)₃PO₄

Given here 1.200 moles of (NH₄)₃PO₄ we have to calculate the given mass of the molecule.

Molecular mass of (NH₄)₃PO₄ is 133 g/mol

Now, mole = Given mass / molecular mass

1.200 = given mass/ 133

Given mass = 160g.

Thus the given mass present in 1.200 moles of (NH₄)₃PO₄ is calculated as 160grams.

The total atomic masses of all the atoms in a molecule make up its molecular mass, also known as molar mass. The molecular mass indicates a molecule’s mass in relation to the 12C atom, whose mass is assumed to be 12. Although molecular mass has no dimensions, it is measured in units of the Dalton or atomic mass unit.

Ammonium phosphate is the inorganic compound with the formula (NH₄)₃PO₄. It is the ammonium salt of orthophosphoric acid. Some fertilizers use ammonium phosphate as an ingredient because it is a rich source of elemental nitrogen.

To learn more about molar mass, refer this link.

https://brainly.com/question/837939

#SPJ9

Answer: Magnesium

Magnesium, in its elemental form, has 12 protons and 12 electrons. The neutrons are a different matter. Magesium's average atomic mass is 24.305 atomic mass units, but no magnesium atom has exactly this mass.

Hope this helps....... Stay safe and have a Merry Christmas!!!!!!!! :D