Fill in the [?]
1.7 km = [?]m
Give your answer in standard form.

Answers

Answer 1

Answer: 1.7 km = [1700]m

1.7 × 10^3

Explanation:

Answer 2

Answer:

1700 meters

Explanation: hope it helps.


Related Questions

the yeastengages in photosynthesis, which produces oxygen gas, bio, quizletquizlet

Answers

The statement “the yeast engages in photosynthesis, which produces oxygen gas” is incorrect. Yeast cells do not engage in photosynthesis to produce oxygen gas.

What is photosynthesis?

Photosynthesis is the process by which green plants use sunlight, carbon dioxide, and water to produce glucose (a simple sugar), which serves as food for the plant.

Oxygen is also produced during photosynthesis.Yeast:Yeast is a unicellular fungus that converts sugar into carbon dioxide and alcohol. Yeast cells respire aerobically in the presence of oxygen and anaerobically in the absence of oxygen.

However, yeast cells do not perform photosynthesis. They do not have chloroplasts or pigments that are required for photosynthesis. Therefore, yeast cells cannot produce oxygen gas.Bio quizlet:Quizlet is an online learning platform that allows users to create and share flashcards, study guides, and quizzes.

It is a great resource for studying biology and other subjects. Students can create their own study materials or use existing ones created by other users. Quizlet provides an engaging and interactive way to learn and retain information.

To know more about photosynthesis :

https://brainly.com/question/20527415

#SPJ11

Which of the following molecules would have the highest boiling point?
a) hexane
b) octane
c) 2-propylpentane
d) 2-methylhexane

Answers

The molecule which would have the highest boiling point is 2-methylhexane. Thus, the correct option will be D.

What is boiling point?

The boiling point is the temperature at which the vapor pressure of a liquid is equal to the external pressure. The boiling point of a liquid is a measure of its vapor pressure. The higher the boiling point, the higher the vapor pressure of the liquid, and the more heat is required to vaporize it.

The boiling point of a substance is affected by the strength and types of intermolecular forces. The stronger the intermolecular forces, the higher the boiling point. 2-methylhexane has highest boiling point because it has the highest number of carbons and branches, which contribute to its strong intermolecular forces that lead to a higher boiling point.

Therefore, the correct option is D.

Learn more about Boiling point here:

https://brainly.com/question/25777663

#SPJ11

What is the percent composition of hydrogen In hydrosulfuric acid? [also the rest of the questions if you’re up for the challenge]

What is the percent composition of hydrogen In hydrosulfuric acid? [also the rest of the questions if

Answers

Hydrogen composition H= 5.93%

What is the daughter nucleus produced when zn63 undergoes electron capture? replace each question mark with the appropriate integer or symbol

Answers

The daughter nucleus that is produced is ₂₉⁶³cu.

What is Electron capture?

The process of drawing an electron to the nucleus, where it combines with a proton to create a neutron and a neutrino particle, is known as electron capture.

The daughter nucleus is the nucleus that is made by the parent nucleus. The nucleus that remains after the decay is called the daughter nucleus.

Here is the chemical formula for the reaction that results in the electron capture of the zinc-63 nucleus:

\(_A^ZX + e^- = _A^Z_-_1 Y + ye\)

\(_3_0^6^3Zn\; + e^- = _2_9^6^3Cu + ye\)

Thus, the daughter nucleus produced when zn63 undergoes electron capture is \(_2_9^6^3Cu\).

To learn more about Electron capture, refer to the below link:

https://brainly.com/question/10964824

#SPJ4

HC2H3O2+NaOH⟶H2O+NaC2H3O2
If you require 32.10 mL of 0.1906 M NaOHNaOH
solution to titrate 10.0 mL of HC2H3O2HCX2HX3OX2
solution, what is the molar concentration of acetic acid in the vinegar?

Answers

The molar concentration of acetic acid in the vinegar is 0.611M

Molar concentration is the most convenient method of expressing the concentration of a solute in the given solution. Molarity is the number of moles of the solute dissolved per liter of the solution.

Thus M = mol per L.

All mole calculations will determine the amount in moles of the solution, for which it is the molar concentration.

Given,

Concentration of NaOH = 0.1906M

Volume of NaOH = 32.1 ml

Volume of acetic acid = 10 ml

During neutralization, the number of moles of acid is the same as the number of moles of base.

concentration of NaOH × Volume = Concentration of acetic acid × volume

0.1906 × 32.1 = Concentration of acetic acid × 10

Concentration of acetic acid = 0.611 M

Learn more about Molar concentration, here:

https://brainly.com/question/15532279

#SPJ4

PLEASE PEOPLE PLEEEEEASEEEREEE PEOPLE HEEEELPPPPP CAN YOU GIVE ME THE ANSWER!!! :,(

PLEASE PEOPLE PLEEEEEASEEEREEE PEOPLE HEEEELPPPPP CAN YOU GIVE ME THE ANSWER!!! :,(

Answers

Answer:

its the middle one

Explanation:

the suns rays bounce off the planet easier at a lower angle.

Answer:

the middle option would heat up the least.

Explanation:

I NEED HELP QUICK Activity:
Part 1: Write all bold vocabulary and define the words (See attached PDF File below). Make sure to number each.

Part 2: Look at the "Second Read of Investigating Landforms On Venus" worksheet (Slide 14) and highlight text to the questions on the worksheet.

Part 3: Answer the questions on the "Second Read of Investigating Landforms On Venus" worksheet: 1) How were the novae on Venus similar to the landforms in Geyra's computer model? AND 2) How did the results of Gerya's model provide evidence for what formed the novae on Venus? (Slide 16)

Part 4: Write the notes: (Slide 19)
3) Scientists can use models to test their ideas and get evidence about processes in the natural world that are difficult to observe.

Exit Slip: How do models help scientists answer questions?

Answers

Lucy and her bike together have a mass of 120 kg. She slows down from 4.5 m/s to 3.5 m/s. How much kinetic energy does she lose?

How many moles of carbon dioxide are there in 52.06 g of carbon dixoide

Answers

Answer:

Moles of substance are defined ratio of the given mass of the substance to the molar mass of the substance.

Given :

The 52.06 grams of carbon dioxide.

To find :

The moles of carbon dioxide.

Solution:

The mass of carbon dioxide = 52.06 g

The molar mass of carbon dioxide = 44.01 g/mol

The moles of carbon dioxide:

1.183 moles of carbon dioxide are there in 52.06 g of carbon dioxide.

Explanation:

1. Which of the following is not among the first twenty elements? A. Chlorine B. Beryllium C. Iron D. Calcium 2. The number of atoms in one mole of an element is referred to as A. molecularity B. chemical symbol C. atomicity D. chemical element 3. What is the chemical symbol of Aluminum? A. AL B. Al C. aL D. al. 4. Which of the following is a heterogeneous mixture? A. Soft drink B. Air C. Flood C. Solution salt 5. Which of the following is false about mixtures? A. They can easily be separated by Chemical method B. They are not represented by chemical formula C. They can be homogenous or heterogeneous D. The constituents are physically combined 6. Which of the following elements is diatomic? A. Sodium B. Potassium C. Helium D. Oxygen 7. A diatomic element has ___________ number of atoms in one molecule of its element. A. one. B. two. C. three. D. four. 8. Which of the following is an example of a colloidal solution? A. Chalk in water B. Sand in water C. Sugar solution D. Solution of eggwhite 9. A mixture whose constituents are uniformly mixed is referred to as a A. homogeneous mixture B. suspension C. heterogeneous mixture D. colloidal solution 10. _____________ is a force that opposes motion when two surfaces are in contact with each other. A. Movement B. Pressure C. Friction D. gravity 11. _____________ is a substance, which cannot be split or broken down into any simpler form by an ordinary chemical process. A. Mixture B. Element C. Compound D. Metals. 12. Alloys are best classified as A. elements B. compounds C. mixtures D. non-metals 13. A type of force which occurs when a body moves constantly over another body is the _______ A. static force B. dynamic force C. magnetic force D. frictional force. 14. Which of the following is NOT a characteristic of friction? A. The ratio of the frictional force and the normal reaction is constant. B. The frictional force is always equal to the force applied through weight. C. Static frictional force is independent of the surface area in contact. D. Friction supports motion. 15. Use of ball or roller bearing on a turning wheel of a machine A. can cause wear and tear of the wheel B. reduces friction between the wheel and the body parts of the machine C. decreases the efficiency of the machine. D. hinders the productivity of the machine. 16. Another way of reducing friction is by A. painting B. alloying C. oiling D. braising 17. A block of wood weighs 4N lies on a horizontal table. Calculate the frictional force between the table and the wood if the coefficient of the static friction is 0.5. A. 1.0N B. 0.2N C. 2.0N D. 0.4N 18. A body of mass 2kg was moved uniformly by a force of 15N, if acceleration due to gravity is 15m/s, determine the coefficient of dynamic friction. A. 0.75 B. 1.5 C. 0.5 D. 1.75 19. The symbol for Beryllium is A. B. B. Be C. Bl D. Bm 20. K is the symbol of A. Calcium B. Chromium C. Potassium D. Krypton

Answers

Answer:

c. iron

Explanation:

iron's atomic number is 26

A 10.0 g sample of a hydrate was heated until all the water was driven off. The mass of the anhydrous product remaining was 8.00 grams. What is the percent of water in the hydrate?

Answers

Answer:

20%

Explanation:

10.0 = 100%

8.00 = 80%

100-80= 20

If you are given a piece of rock sugar about 2.5 cm in diameter, describe three steps you can take to dissolve it in a beaker of water in the shortest time.​

Answers

Answer:

1. Crush the sugar into powder.

2. Heat the water.

3. Dissolve it by stirring continuously

Explanation:

1. Crushing the sugar into powder increases surface area. So it increases the changes of dissolving

2. Heating the water increases the capacity of water to dissolve sugar.

3. Stirring continuously increases randomness of particles so eases mixing up thus increasing dissolving tendency.

Carbon monoxide gas reacts with hydrogen gas atelevated temperatures to form methanol according to thisequation.
CO(g) + 2H2(g)Image:UCH3OH(g)
When 0.40 mol of CO and 0.30 mol of H2are allowed to reach equilibrium in a 1.0 L container, 0.060 mol ofCH3OH are formed. What is the value of Kc?
Please EXPLAIN youranswer.

Answers

Given equation is,

CO(g) + 2H2(g) ⇌ CH3OH(g)

At equilibrium, the amount of CH3OH(g) formed = 0.060 mol

Number of moles of CO(g) = 0.40 mol

Number of moles of H2(g) = 0.30 mol

The number of moles of CH3OH(g) formed per mole of CO(g) =0.060 mol/0.40 mol = 0.150

The number of moles of CH3OH(g) formed per mole of H2(g) =0.060 mol/ (0.30 × 2) mol = 0.100

Since, the coefficients of all the species in the balanced equation are 1 or 2, so the equilibrium constant expression can be written as,

Kc = [CH3OH]/ [CO][H2]

Since, at equilibrium, the amount of CH3OH(g) formed = 0.060 mol, the amount of CO(g) reacted = 0.40 - 0.060 = 0.34 mol, and the amount of H2(g) reacted = 0.30 - (0.060/2) = 0.27 mol

Putting these values in the above equation,

Kc = (0.060/1.0) / [(0.34/1.0) × (0.27/1.0)]Kc = 0.150

Therefore, the value of Kc is 0.150.

Learn more about equilibrium on:

https://brainly.com/question/33713818

#SPJ11

Can someone help me please!

Can someone help me please!

Answers

Answer:

It tells you on the chart I've attached. It's all color coded. :p

Can someone help me please!

Which of these statements best describes how scientific ideas change? a. New evidence leads to the modification of ideas. b. As a scientific idea changes, it eventually becomes a scientific theory and, ultimately, a law. c. Scientific ideas rarely change because they are based on extensive evidence. d. Scientists form opinions based on evidence and decide how the idea should change.

Answers

Answer: I think is A

Explanation:

I believe it's A.

For example, the scientific community used to believe that we lived in a geocentric solar system when in reality, we live in a heliocentric solar system. This idea was proved over time due to famous scientists such as Galileo Galilei, Nicolaus Copernicus, and James Bradley over a course of many years and as such, ideas changed with new scientific evidence.

In the Millikan oil droplet experiment, the oil is sprayed from an atomizer into a chamber. The droplets are allowed to pass through the hole into the chamber so that their fall can be observed. The top and bottom of the chamber consist of electrically charged plates. The upper plate is positively charged, and the lower plate is negatively charged. X rays are introduced into the chamber so that when they strike the oil droplets, the droplets will acquire one or more negative charges. The electric field (voltage) is applied to the metal plates.
Watch the animation and identify the effects of an electric field on the motion of a negatively charged oil droplet. Consider the gravitational force as Fg and the electric force as Fe. All the other forces acting on the oil droplet can be ignored as their effect on the motion of the oil droplet is negligible.
A/ In the absence of an electric field, the oil droplet falls freely due to the gravitational force.
B/ If Fe is increased until it is equal to Fg, the negatively charged oil droplet will remain stationary.
C/ If Fe is greater than Fg, the negatively charged oil droplet will move freely toward the negatively charged plate.
D/ In the presence of an electric field, the negatively charged oil droplet moves freely toward the negatively charged plate.
** I chose B, but that was the wrong answer

Answers

C/ If Fe is greater than Fg, the negatively charged oil droplet will move freely toward the negatively charged plate.

In the Millikan oil droplet experiment, the negatively charged oil droplets are subjected to an electric field created by the charged plates. The electric force (Fe) acts on the oil droplet in a direction opposite to the gravitational force (Fg). When Fe is greater than Fg, the electric force overcomes the gravitational force, causing the negatively charged oil droplet to experience an upward force. As a result, the oil droplet moves freely upward toward the negatively charged plate.

Option B is incorrect because if Fe is equal to Fg, the forces balance each other, resulting in a stationary droplet. However, the question states that Fe is increased until it is greater than Fg, implying that the droplet is no longer stationary but moves in response to the electric force.

Therefore, option C is the correct answer, as it describes the effect of an electric field on the motion of a negatively charged oil droplet in the Millikan oil droplet experiment.

To learn more about Millikan oil droplet experiment, here

https://brainly.com/question/32330429

#SPJ4

How much heat (in kj ) is required to vaporize it? (assume a density of 1. 00 g/ml. ).

Answers

Q = 203,250 kJ heat is required to vaporize.

The amount of heat required to vaporize a substance is known as its heat of vaporization. To calculate the heat of vaporization in kJ, you will need to know the substance's specific heat of vaporization (ΔHvap), which is the amount of heat required to vaporize one mole of the substance at its boiling point. You can also use the following equation: Q = mLΔHvap , Where Q is the heat energy in kJ, m is the mass of the substance in grams and L is the substance's heat of vaporization .Missing text find on internet: a 90,0 mL sample of water is heated to its boiling point. V(H₂O) = 90,0 mL. d(H₂O) = 1,00 g/mL. m(H₂O) = 90 mL · 1,00 g/mL. m(H₂O) = 90 g. n(H₂O) = m(H₂O) ÷ M(H₂O). n(H₂O) = 90 g ÷ 18 g/mol. n(H₂O) = 5 mol. Q = n(H₂O) · ΔHvap Q = 5 mol · 40.65 kJ/mol. Q = 203,250 kJ. Q - heat reqiured.

Learn more about mole here :

https://brainly.com/question/29367909

#SPJ4

Within the textbook, the idea that goods would be equally distributed if the distributor was not allowed to know of his/her status or position is referred to as _____________.

Answers

Within the textbook, the idea that goods would be equally distributed if the distributor was not allowed to know of his/her status or position is referred to as the veil of ignorance.

This concept, introduced by philosopher John Rawls, suggests that in a just society, individuals should make decisions about the distribution of resources and opportunities without any knowledge of their own advantages or disadvantages in that society.

The veil of ignorance serves as a thought experiment to encourage impartiality and fairness, as decision-makers would be motivated to create a system that benefits everyone, regardless of their personal circumstances, ensuring a more equitable distribution of goods.

To know more about veil of ignorance  refer here

brainly.com/question/30765452#

#SPJ11

How do we introduce ourselves using the periodic table?

Answers

Answer: Each element on the periodic table is listed in a box with its atomic symbol and atomic number. The element's full name and atomic mass is also sometimes indicated. The image below shows a typical entry for the element calcium. The number above the atomic symbol represents the atomic number.

What method could be used to separate the components of gasoline?

Answers

Explanation:

The separation of gosoline from crude oil by heating until it reaches its boilling point is a separation technique called fractional distillation .It is the separation of a mixture such oil into their respect fraction.

Answer:

The answer is B, Distillation.

Explanation:

Which of Earth's Spheres take up most of the Earth's surface?

Hydrosphere
atmosphere
cryosphere
geosphere

Answers

answer is: hydrosphere

A piece of silver metal weighting 194.3g placed in graduated cylinder containing 242.0ml of water the volume of water now reads 260.5ml,calculate the density of the metal

Answers

Explanation:

Volume of metal = 260.5ml - 242.0ml = 18.5ml

Density = Mass / Volume = 194.3 / 18.5 = 10.5g/cm³.

For a 80- g sample of fused copper catalyst, a volume of 7.6×103 mm3 of nitrogen (measured at standard temperature and pressure, 0 ∘c and 1 atm ) is required to form a monolayer upon condensation. calculate the surface area of the catalyst. (take the area covered by a nitrogen molecule as 0.162 nm2 and recall that, for an ideal gas, pv=nrt , where n is the number of moles of the gas.)

Answers

Answer:

First, we need to calculate the number of moles of nitrogen gas required to form a monolayer:

n = (pv) / (rt)

where p is the pressure, v is the volume, r is the ideal gas constant, and t is the temperature in Kelvin.

At standard temperature and pressure, we have:

p = 1 atm

v = 7.6×10^3 mm^3 = 7.6×10^-6 m^3

t = 273 K

r = 8.31 J/(mol K)

So, n = (1 atm x 7.6×10^-6 m^3) / (8.31 J/(mol K) x 273 K) = 3.13×10^-7 mol

Next, we can calculate the number of nitrogen molecules in this amount of gas:

N = n x Na

where Na is Avogadro's number (6.02×10^23 molecules/mol).

N = 3.13×10^-7 mol x 6.02×10^23 molecules/mol = 1.88×10^17 molecules

Finally, we can calculate the surface area of the catalyst covered by these molecules:

A = N x a

where a is the area covered by a nitrogen molecule (0.162 nm^2), converted to m^2.

a = 0.162 nm^2 x (10^-18 m^2/nm^2) = 1.62×10^-20 m^2

A = 1.88×10^17 molecules x 1.62×10^-20 m^2/molecule = 3.05×10^-3 m^2

Therefore, the surface area of the catalyst covered by the nitrogen molecules is approximately 3.05×10^-3 m^2.

Question 1 (2 points)

2.5 L of a gas is heated from 200 K to 300 K. What is the final volume of the gas?

Answers

Answer:

3.75 L

Explanation:

We can solve this problem by using Charles' law, which states:

V₁T₂=V₂T₁

Where subscript 1 stands for initial volume and temperature and subscript 2 for final volume and temperature, meaning that in this case:

V₁ = 2.5 LT₂ = 300 KV₂ = ?T₁ = 200 K

We input the data:

2.5 L * 300 K = V₂ * 200 K

And solve for V₂:

V₂ =  3.75 L

what are two bones that make blood cells.

(name of the bones) :)

Answers

Answer:

Long bones contain yellow bone marrow and red bone marrow, which produce blood cells.

Explanation:

Have a nice night!

The majority of your blood cells are produced in your bone marrow. This is known as haemopoiesis. In children, haemopoiesis occurs in the long bones, such as the thighbone (femur). Adults have it mostly in their spine (vertebrae), hips, ribs, skull, and breastbone (sternum).

What is haemopoiesis ?

Hematopoiesis is the process by which all the cellular components of blood and blood plasma are produced. It happens in the hematopoietic system, which includes organs and tissues like bone marrow, liver, and spleen. Simply put, hematopoiesis is the process by which the body produces blood cells.

The bone marrow is where blood cells are created. The soft, spongy material in the center of the bones is called bone marrow. It generates approximately 95% of the body's blood cells. The pelvic bones, breastbones, and spine bones contain the majority of the adult body's bone marrow.

Red cells are constantly produced in the marrow of certain bones. As previously stated, the marrow is the primary site of red cell production, known as erythropoiesis, in adults.

Thus, The majority of your blood cells are produced in your bone marrow. This is known as haemopoiesis.

To learn more about haemopoiesis, follow the link;

https://brainly.com/question/24372216

#SPJ2

Which shows the correct order of steps during the formation of an ionic bond?a. ions are attracted to each other → electrons are transferred → an ionic compound forms b. an ionic compound forms → ions are attracted to each other → electrons are transferred c. electrons are transferred → ions form → ions are attracted to each other d. ions form → electrons are transferred → ions are attracted to each other

Answers

The correct order of steps during the formation of an ionic bond is:

c. electrons are transferred → ions form → ions are attracted to each other.

This means that first, electrons are transferred from one atom to another to form ions with opposite charges. Then, these ions are attracted to each other by electrostatic forces, resulting in the formation of an ionic compound.

Option (a) is incorrect because it shows the attraction of ions occurring before the transfer of electrons.

Option (b) is incorrect because it shows the formation of an ionic compound occurring before the attraction of ions.

Option (d) is incorrect because it shows the attraction of ions occurring after the transfer of electrons.

For more question on ionic bond click on

https://brainly.com/question/957239

#SPJ11

State and explain law of multiple proportion with example.

Answers

Answer:

Whenever the same two elements form more than one compound, the different masses of one element that combine with the same mass of the other element are in the ratio of small whole numbers.

Explanation:

I attached a pdf hope it helps.

State and explain law of multiple proportion with example.

How many grams of the exess reactant remain assuming the reaction goes to completion and that you start with 15.5?

Answers

0g  is the mass in grams of the excess reactant remain assuming the reaction goes to completion and that you start with 15.5.

The term "excess reactant" in chemical reactions describes a reactant that is present in a higher concentration than what is necessary for a complete reaction with the other reactants. This implies that even after the reaction has reached its end, some of the excess reactant will remain. Stoichiometry, or the study of the quantitative correlations between reactants and products, is closely related to the idea of an excess reactant in a process.

Molar mass of Na2S = 46.04 g/mol

Moles of Na2S = 15.5 g / 46.04 g/mol = 0.3362 mol

Molar mass of CuSO4 = 159.61 g/mol

Moles of CuSO4 = 12.1 g / 159.61 g/mol = 0.0759 mol

moles of Na2SO4 formed = 0.3362 mol

Molar mass of Na2SO4 = 142.04 g/mol

Grams of Na2SO4 formed = 0.3362 mol * 142.04 g/mol = 47.77 g

Excess reactant remaining in moles = 0.3362 mol - 0.3362 mol = 0 mol

Grams of the excess reactant remaining = 0 mol * 46.04 g/mol = 0 g

To know more about excess reactant, here:

https://brainly.com/question/31209189

#SPJ4

if element X has two valence electrons and element Y has five valence electrons the formula for the compound is?

Answers

Answer:

the answer to the question is X3Y2

Which sentence best describes the concept of Redshift?

Answers

Answer:

'Red shift' is a key concept for astronomers. The term can be understood literally - the wavelength of the light is stretched, so the light is seen as 'shifted' towards the red part of the spectrum.

Something similar happens to sound waves when a source of sound moves relative to an observer. This effect is called the 'Doppler effect' after Christian Andreas Doppler, an Austrian mathematician who discovered that the frequency of sound waves changes if the source of sound and the observer are moving relative to each other.

If the two are approaching, then the frequency heard by the observer is higher; if they move away from each other, the frequency heard is lower.

There are many everyday examples of the Doppler effect - the changing pitch of police and ambulance sirens, or train whistles and racing car engines as they pass by. In every case, there is an audible change in pitch as the source approaches and then passes an observer.

Everyone has heard the increased pitch of an approaching police siren and the sharp decrease in pitch as the siren passes by and recedes. The effect arises because the sound waves arrive at the listener's ear closer together as the source approaches, and further apart as it recedes.

Light behaves like a wave, so light from a luminous object undergoes a Doppler-like shift if the source is moving relative to us. Ever since 1929, when Edwin Hubble discovered that the Universe is expanding, we have known that most other galaxies are moving away from us. Light from these galaxies is shifted to longer (and this means redder) wavelengths - in other words, it is 'red-shifted'.

Since light travels at such a great speed relative to everyday phenomena (a million times faster than sound) we do not experience this red shift in our daily lives.

The red shift of a distant galaxy or quasar is easily measured by comparing its spectrum with a reference laboratory spectrum. Atomic emission and absorption lines occur at well-known wavelengths. By measuring the location of these lines in astronomical spectra, astronomers can determine the red shift of the receding sources.

However, to be accurate, the red shifts observed in distant objects are not exactly due to the Doppler phenomenon, but are rather a result of the expansion of the Universe.

Doppler shifts arise from the relative motion of source and observer through space, whereas astronomical redshifts are 'expansion redshifts' due to the expansion of space itself.

Two objects can actually be stationary in space and still experience a red shift if the intervening space itself is expanding.

A convenient analogy for the expansion of the Universe is a loaf of unbaked raisin bread. The raisins are at rest relative to one another in the dough before it is placed in the oven. As the bread rises, it also expands, making the space between the raisins increase.

If the raisins could see, they would observe that all the other raisins were moving away from them although they themselves were stationary within the loaf. Only the dough - their 'Universe' - is expanding.

how many atoms of calcium were left on the paper?
the compound is CaCO3
there is 1.57x10622 atoms on the paper
im not sure how to figure out the individual element helpppppp

Answers

There were 1.58 x 10^20 atoms of calcium left on the paper.

Steps

To determine the number of calcium atoms in CaCO3, we first need to know the molecular formula weight of CaCO3, which is 100.0869 g/mol.

Then, we can use this formula to calculate the number of moles of CaCO3:

moles of CaCO3 = mass of CaCO3 / molecular weight of CaCO3

mass of CaCO3 = (1.57 x 10^22 atoms) x (100.0869 g/mol / 6.022 x 10^23 atoms/mol) = 2.62 x 10^-2 g

Now we can calculate the number of moles of CaCO3:

moles of CaCO3 = 2.62 x 10^-2 g / 100.0869 g/mol = 2.62 x 10^-4 mol

number of calcium atoms = moles of CaCO3 x Avogadro's number

number of calcium atoms = 2.62 x 10^-4 mol x 6.022 x 10^23 atoms/mol = 1.58 x 10^20 atoms

Therefore, there were 1.58 x 10^20 atoms of calcium left on the paper.

learn more about atoms of calcium here

https://brainly.com/question/24751502

#SPJ1

Other Questions
In the wealthy mare comprehension who is refered to as grey In circle t, s is a point of tangency. find the radius (r) of circle t. given ur = 36 cm and sr = 48 cm Austin has a terrible fear of public speaking. When he gets up to speak, his heart races. Afterwards, he calms down quickly. These contrasting reactions are regulated by the _____________ nervous system. Are used to measure distances north and south of the equator. lines of longitude and latitude are measured in . the prime meridian is located at degrees longitude. are not an equal distance apart; they grow closer together as they reach the north and south poles. Arrange the compounds in order of decreasing boiling point.Rank the compounds from the highest to lowest boiling point.(CH3)2(CH3CH2)NCH3CH2CH2CH2NH2CH3CH2CH2CH2OH ______ types of databases are also called information utilities or data banks. penne pharmaceuticals sold 17 million shares of its $1 par common stock to provide funds for research and development. if the issue price is $14 per share, what is the journal entry to record the sale of the shares? what is the ph of the following solution after adding 0.0060 mol of hcl to a 1l buffer solution that is 0.213 m phenol(aq) and 0.132 m sodium phenolate (C6H5ONa) (aq)?a. 8.95b. 9.76c. 9.79d. 9.82e. 10.24 One number is six less than a second number. Twice the first is 12 more than 6 times the second. Find the numbers.The value of the first number isThe value of the second number is A description of a sediment sample, stating that it contains large, angular fragments that are mostly red in color would represent what type of data? Quixlet which class of antiarrhythmics decreases depolarization, depresses sodium conduction, and is sometimes referred to as sodium channel blocks? What agricultural industry currently dominates the steppe landscape in the north european lowlands? which statement most accurately describes economics? group of answer choices economics is the study of how people make choices to satisfy their wants. economics is the study of how to eliminate scarcity. economics is the study of social values a society should choose. economics is the study of how people make money. What are two responsibilities of the release train engineer during program increment execution When using back translation, the translations are good ifMultiple Choicethe translators are both native speakers of the language they are translating from.the second translation matches the original message.the first translation and the second translation match.both translations are confirmed by a third translator.the translators translate into their own native languages.When Felipa meets with a client, she likes to spend the first half hour or so of the meeting chatting about the client's life and current events. Felipa is most likely a member of a ______ culture.Multiple Choicepolychroniclong-term orientationmonochroniclow-contexthigh-contextWhich of the following statements about the expression of emotion in different cultures is true?Multiple ChoiceAlmost all cultures display grief in the same way.Displays of amusement, such as smiles and laughter, are spontaneous and thus are universal to all cultures.Public displays of affection not encouraged in any culture.Some cultures expect communication to be subdued, while others communicate loudly and with emotion.All cultures value straightforward, emotionless, and efficient communications.When explaining a proposal to business associates, Adelaide makes sure to explicitly state all relevant background information. Adelaide most likely belongs to a ______ culture.Multiple Choicepolychronichigh-contextlow-contextmonochronichigh power distanceWhich of the following statements about body movements is true?Multiple ChoiceIf you nod your head, everyone will know what you mean, regardless of which culture they belong to.The different ways cultures use physical behaviors do not affect communication.Hand gestures may mean different things in different cultures, but eye contact always conveys the same message.Countries that speak English all apply the same meanings to particular hand gestures.Some body movements have clear meanings in a culture while others have no definite meaning.Which of the following combines a verb with a second element to create a meaning that the verb does not have alone?Multiple Choiceadjectivestwo-word verbsconjunctionscolloquialismshigh-context verbs find the area of the polygon with the given vertices W(0,0), X(0, 3), Y(-3,3), Z(-3,0) What would be the effect on the calculated value of the efficiency of the following systematic errors of measurement? What is the slope of the line that passes through the points (-4,-1) and (-2,-5)? Among the____________magic involves the use of plant material, called medicines, in which supernatural power resides. A hula hoop has a mass of 1.5 kg, a moment of inertia of 2.16 kg*m2, and a radius of 0.060 m. If it rolls down your driveway without slipping at a linear speed of 4.0 m/s, what is its total kinetic energy?