ruthenium (ru) has an abnormal electron configuration that causes ru to form ru 1, ru 3, and ru 7 ions. please draw the noble gas electron configuration of ru and explain why it forms those ions.
Answers
As can be seen from the periodic chart, silver and ruthenium are classified as belonging to the same period, the fifth period. Rutanium has an atomic number of 44, whereas silver has an atomic number of 47.
What is Ruthenium ?Ru Its atomic number 44 identify the chemical element ruthenium. It is an uncommon transition metal from the periodic table's platinum group. Rutanium is inert to the majority of other compounds, just like the other platinum group metals.
Solar cells, which convert light energy into electrical energy, can use ruthenium molecules. One of the best hardeners for platinum and palladium is ruthenium, which is alloyed with these metals to provide electrical connections with extremely high wear resistance. In certain jewelry, it is combined with platinum as an alloy.
What is Electron configuration ?The arrangement of an atom's or molecule's electrons in atomic or molecular orbitals is known as the electron configuration in atomic physics and quantum chemistry.
Divide the periodic table into pieces to represent the atomic orbitals, the areas where electrons are stored, in order to determine an electron configuration. The s-block is represented by groups one and two, the d-block by groups three through twelve, the p-block by groups thirteen to eighteen, and the f-block by the bottom two rows.
To know more about Ruthenium please click here ; https://brainly.com/question/1096242
#SPJ4
Related Questions
Fill in the table with the correct number of each subatomic particle for the elements given the isotope mass number. (12 pts)
Answers
You can fill in the table for other elements and their respective isotopes by determining the appropriate number of protons, neutrons, and electrons based on the given isotope mass number and atomic number.
To accurately fill in the table with the correct number of subatomic particles for the elements given the isotope mass number, we need to consider the composition of atoms and their respective subatomic particles. Atoms are composed of protons, neutrons, and electrons.
The number of protons in an atom is equivalent to its atomic number, which uniquely identifies the element. The number of neutrons can be determined by subtracting the atomic number from the isotope mass number. Electrons in a neutral atom are equal to the number of protons.
Let's take an example using the isotope mass number:
Isotope: Carbon-14 (mass number = 14)
Element: Carbon (atomic number = 6)Based on the atomic number and isotope mass number, we can determine the number of subatomic particles as follows:
Protons: 6 (same as the atomic number)
Neutrons: 14 - 6 = 8
Electrons: 6 (same as the number of protons in a neutral atom)
For morew such questions on elements visit:
https://brainly.com/question/18096867
#SPJ8
You have a 100 gram sample of each of the following metals. Which sample has the largest volume?
*the sample with the lowest density would have the greatest volume
1) aluminum, d= 2.7 g/cm^3
2) gold, d = 19.3 g/cm^3
3) iron, d = 7.86 g/cm^3
4) magnesium, d = 1.74 g/cm^3
5) silver, d = 10.5 g/cm^3
Answers
To determine which metal sample has the largest volume among the given options, we need to compare their densities. The sample with the lowest density will have the greatest volume for a given mass.
Let's calculate the volumes of the metal samples using the formula:
Volume = Mass / Density
1) For aluminum: Mass = 100 g, Density = 2.7 g/cm^3
Volume of aluminum = 100 g / 2.7 g/cm^3 = 37.04 cm^3
2) For gold: Mass = 100 g, Density = 19.3 g/cm^3
Volume of gold = 100 g / 19.3 g/cm^3 = 5.18 cm^3
3) For iron: Mass = 100 g, Density = 7.86 g/cm^3
Volume of iron = 100 g / 7.86 g/cm^3 = 12.72 cm^3
4) For magnesium: Mass = 100 g, Density = 1.74 g/cm^3
Volume of magnesium = 100 g / 1.74 g/cm^3 = 57.47 cm^3
5) For silver: Mass = 100 g, Density = 10.5 g/cm^3
Volume of silver = 100 g / 10.5 g/cm^3 = 9.52 cm^3
Learn more about densities here: brainly.com/question/17596236
#SPJ11
What is the [H+] if the pH of a solution is 7.60
Coefficient? exponent?
Remember to use the appropriate amount of significant figures.
Answers
The hydrogen ion concentration is 2.5 * 10^-8 M
What is the pH?The pH is a measure of the acidity or basicity of a solution. It is defined as the negative logarithm of the concentration of hydrogen ions in a solution. The pH scale ranges from 0 to 14, where a pH of 7 is neutral, a pH below 7 is acidic, and a pH above 7 is basic (alkaline).
Given that;
[H+] = Antilog (-pH)
= Antilog (-7.60)
= 2.5 * 10^-8 M
The pH is an important concept in many fields, including chemistry, biology, and environmental science. It is used to measure the acidity or basicity of a variety of substances, including soil, water, and biological fluids.
Learn more about pH:https://brainly.com/question/15289714
#SPJ1
a 0.0718 mol sample of an unknown gas contained in a 2.00 l flask is found to have a density of 1.51 g/l. the molecular weight of the unknown gas is g/mol.
Answers
The molecular weight of the unknown gas is 42.06 g.
Find out the molecular weight of unknown gas.The idea is that the density of the gas tells you the mass of this gas that occupies exactly 1 L under some unspecified pressure and temperature conditions.
In this case, you know that the density of the gas was 1.51g/L.
This means that 1.51 g/L of this gas occupies exactly 1 L under the pressure and temperature conditions used in the experiment.
You are also aware that the total volume of the flask is 2.00 L. At this point, you can use the density of the gas to calculate the mass of gas required to fill the given volume with the sample.
\(2.00 L . \frac{1.51g}{1L} =3.02g\)
You must now determine the mass of exactly one mole in order to determine the molar mass of the gas. Since you are aware that this sample contains 0.0718 moles of gas and weighs 12.5 g, you can infer that one mole will weigh that much.
\(1 mol. gas .\frac{3.02g}{0.0718} =42.06g\)
As a result, the gas's molar mass can be expressed as molar mass = 42.06 g/ mol.
This indicates that 42.06 g makes up 1 mole of this gas.
Learn more about molar mass here:-
https://brainly.com/question/5216907
#SPJ4
How many grams of N2 are in 3.0 x 1023 molecules of N2?
Answers
The mass of 3.0 x 10²³ molecules of nitrogen gas is 13.95 g.
Mass of the Nitrogen gas
The mass of one mole of Nitrogen gas is 28 g/mol.
Number of atomsThe number of atoms in one mole of Nitrogen gas is 6.022 x 10²³ molecules.
The mass of Nitrogen gas in the given number of molecules is calculated as follows;
6.022 x 10²³ --------------------- 28 g/mol
3.0 x 10²³ ----------------------------- ?
\(= \frac{3.0 \times 10^{23} \times 28}{6.022 \times 10^{23} } \\\\= 13.95 \ g\)
Thus, the mass of 3.0 x 10²³ molecules of nitrogen gas is 13.95 g.
Learn more about mass of gas molecules here: https://brainly.com/question/11641158
1. How many particles are in 8.14 moles of Na?
Answers
Answer:
8.14x6.022×10^23 ~ 4.901908x10^24
Explanation:
Elisa's diabetes could affect her body's ability to grow and repair cells because
Answers
Answer:
She wouldn't produce proper insulin
Explanation:
Diabetes is a diasese in which blood cells and fat cells are effected but it's worse on the blood cells because the bloods cells don't produce and revive enough insulin
a solution is made by dissolving 2.3g ethanol (c2h5oh) in 16.2 g water. what is the mass percent of ethanol?
Answers
The solution's ethanol has a molality of 3.70 mol/kg. The amount of material that must be dissolved in a given mass of a solvent is related to a solution's molality.
From the information provided:
water mass = 16.2 g
mass of ethanol = 2.3 g
1000 g make up 1 kilogram of water. There are 0.0162 kilogram of water in 16.2 g of water.
As a result, ethanol's molality is:
= 3.70 mol/kg
Molality is determined by dividing the kilograms of solvent by the moles of solute (the substance being dissolved) (the substance used to dissolve).
Learn more about molality here:
https://brainly.com/question/9149034
#SPJ4
Think of the different types of reactions you have learned about. How can you tell if they absorb energy or release energy, and at the molecular level, how are they different?
Answers
Answer:
Absorbed will be harder to spot than releasing because take this as it's like a tire. A tire will go smaller when it has no air compared to when it has air. But absorbed it the opposite. It gets bigger with more air and etc.
Explanation:
My answer don't copy and paste change it a little.
What occurs to a sound wave as it passes from air into a vacuum?
Answers
Hope this helps:)
Answer:
Sound waves cannot propagate in vacuum. Air is needed for sound waves to travel and there is no air in vacuum.
Explanation:
If you rewrite the following word equation as a balanced chemical equation, what will the coefficient and symbol for fluorine be? nitrogen trifluoride = nitrogen + fluorine.
Answers
If the given word equation is rewritten as a balanced chemical equation, the coefficient for fluorine will be 3 and the symbol for fluorine will be F.
A balanced chemical equation is one in which the number of atoms of each element on the left side of the equation is equal to the number of atoms of each element on the right side of the equation. In the case of the given equation, the balanced chemical equation would be:
N2 + 3F2 → 2NF3
In this equation, the coefficient for fluorine (F2) would be 3 and the symbol for fluorine would be F. This means that there are three molecules of fluorine present in the reaction, and the symbol for fluorine is F.
In summary, if the given word equation is rewritten as a balanced chemical equation, the coefficient for fluorine will be 3 and the symbol for fluorine will be F.
Learn more about balanced chemical equation at : https://brainly.com/question/28294176
#SPJ4
Consider the acid-base reaction and classify each of the reactants and products as an acid or base according to the Brønsted theory. CF3COOH + H20 근 H30' + CF3COO- Acid Base Answer Bank CE,CoO CF,COOH 8 9 6
Answers
According to the Brønsted theory, an acid is a substance that donates a proton (H+), and a base is a substance that accepts a proton. In the given reaction:
CF3COOH + H2O → H3O+ + CF3COO-
CF3COOH is an acid because it donates a proton to H2O.
H2O acts as a base because it accepts a proton from CF3COOH.
In the products:
H3O+ is an acid because it has an extra proton.
CF3COO- is a base because it has accepted a proton from CF3COOH.
So, the classification is:
CF3COOH - Acid
H2O - Base
H3O+ - Acid
CF3COO- - Base
Learn more about Bronsted theory here:
https://brainly.com/question/30460067
#SPJ11
All of the molecules in a cup of water are moving at the same speed or at a variety of speeds explain ?
Answers
Answer:
They will move at the same speed
Explanation:
This will depend on the heat of the water. The hotter the water is the more the molecules move around. As the water cools it will make the molecules move slower.
Hope this helps! :)
Why does it make sense that stars and planets form before atoms?
Answers
Answer:
it doesn't make sense bro. how are they gonna form before atoms if they are made out of atoms? everything is
Explanation:
Under the influence of gravity, atoms came together and resulted in a blast causing the "big bang". So the statement is false as stars and planets are formed due to the colliding of atoms.
What is the big bang theory?
About 13.7 billion years ago, the universe underwent a dramatic expansion that caused space to expand like a huge balloon.
That sums up the Big Bang idea, which is accepted by almost all cosmologists and theoretical physicists. The theory is backed up by a lot of strong data. For instance, we are aware that the universe is still expanding right now, and that this expansion is speeding up.
According to the conventional Big Bang theory, the beginning of the universe involved a singularity, a region of infinite temperature and density whose nature is difficult for humans to comprehend. However, scholars assert that this may not truly reflect reality because the singularity idea is based on Einstein's theory of general relativity.
The origin of the cosmos is still mostly unknown. A trillionth of a second after the Big Bang, according to scientists, is where the tale may be picked up.
Therefore, the statement is false.
Read more about the big bang theory, here
https://brainly.com/question/1160650
#SPJ2
For each of the following pairs of compounds, choose which will elute faster in a TLC experiment (i. E. , which compound will have a larger Rf value). Explain what factors led to your choice. 6 pt a. Naphthalene or 1-Bromonaphthalene Choice Explanation: 1-Bromonaphthalene is more polar than Naphthalene. If polarity is higher, its Rf value will be less which means that molecule will travel less distance (lower Rf value) during a TLC experiment
Answers
In a TLC experiment, the compound with the larger Rf value will elute faster. In the case of naphthalene and 1-bromonaphthalene, the 1-bromonaphthalene will elute faster and have a larger Rf value.
This is because 1-bromonaphthalene is more polar than naphthalene. Polar compounds have a stronger attraction to the polar stationary phase (such as the silica gel in TLC plates) and will interact more with it, resulting in a lower Rf value.
Naphthalene, on the other hand, is less polar and will have a weaker interaction with the stationary phase, allowing it to travel further and have a higher Rf value.
The polarity of a compound is determined by the presence of functional groups or atoms that create an uneven distribution of charge or electronegativity. In this case, the bromine atom in 1-bromonaphthalene increases its polarity compared to naphthalene, leading to a stronger interaction with the stationary phase.
In summary, the 1-bromonaphthalene will elute faster in a TLC experiment and have a larger Rf value compared to naphthalene due to its higher polarity resulting from the presence of a bromine atom.
To know more about electronegativity refer to this:
https://brainly.com/question/3393418
#SPJ11
what is the ph of 0.779 m ethylammonium chloride, c2h5nh3cl. the kb of ethylamine, c2h5nh2, is 4.3 x 10-4.
Answers
The pH of 0.779 M ethylammonium chloride (C2H5NH3Cl) is 10.08. What is ethylammonium chloride? Ethylammonium chloride is a chloride salt that is formed from the reaction between ethylamine and hydrochloric acid.
Ethylamine (C2H5NH2) is the primary component in the synthesis of ethylammonium chloride. When ethylamine is added to hydrochloric acid, a white solid is formed that has the chemical composition C2H5NH3Cl.How to find pH of ethylammonium chloride?The Kb value for ethylamine is given as 4.3 x 10^-4.
The reaction for ethylamine is:C2H5NH2(aq) + H2O(l) ⇌ C2H5NH3+(aq) + OH-(aq)We can assume that ethylammonium chloride is completely ionized. So, we can write:C2H5NH3Cl → C2H5NH3+ + Cl-The hydrolysis of the ethylammonium ion is given by the following equation: C2H5NH3+ (aq) + H2O(l) ⇌ C2H5NH2(aq) + H3O+(aq)Therefore, Kb = [C2H5NH2][H3O+]/[C2H5NH3+]Let's assume x is the H3O+ ion concentration. Then [C2H5NH2] = [H3O+] and [C2H5NH3+] = 0.779 - x.Substituting these values in the above equation, we get the equation: 4.3 x 10^-4 = x^2 / (0.779 - x)By solving the above equation, we can get x, which is the H3O+ ion concentration. Once we get x, we can calculate the pH of the solution, which is given by the equation:pH = - log [H3O+]Finally, by substituting the value of [H3O+] we get the pH of the solution. PH of the solution is 10.08.
learn more about ph of ethylammonium chloride at: brainly.com/question/31096747
#SPJ11
What is the future of Nanoparticles in medicine
Answers
Answer:
nanoparticle cancer drugs could act like biological missiles that destroy tumors while minimizing damage to healthy organs
What is the mass of an object that has a density of 2,86 g/mL and a volume of
75 mL
Answers
Answer:
214.5 gExplanation:
The mass of a substance when given the density and volume can be found by using the formula
mass = Density × volume
From the question we have
mass = 75 × 2.86
We have the final answer as
214.5 gHope this helps you
Which of the following phase changes requires the addition of thermal energy?*
• Condensation
• Vaporization
• Deposition
• Freezing
Will mark the person who answers correctly Brainliest<\3
Answers
Answer: Option (b) is the correct answer.
Explanation:
When thermal energy is added to a substance then there will occur an increase in the kinetic energy of molecules. As a result, motion of particles increases due to which a solid substance changes into liquid state and a liquid substance changes into gaseous state.
When a liquid substance gets converted into vapors or gaseous state then this process is called vaporization.
Thus, phase changes that requires the addition of thermal energy is vaporization.
• vaporization
Types of Organisms:
Identify each organism in the diagram below and label each as a producer,
decomposer, herbivore, carnivore, or omnivore.
nutrients
What do the direction of the arrow between each organism represent?
To the left create your
own simple food
chain. Insert images
to do this.
Answers
Answer:
Part A
The green plant is a producer
The grasshopper is a herbivore
The Rat is a Omnivore
The snake is a Carnivore
The eagle is a Carnivore
The mushroom is a Decomposer
Part B
The arrow between each organism indicates the direction of energy flow which shows the direction in which the energy transfer takes place from one organism to the next, with the general source of energy for all animals being the Sun.
Part C
A sample food chain can be presented as follows;
Sun, Green plants → worms → Frogs → Snakes → Coyotes → Bears → Tigers → Mushroom → Plants
Explanation:
If a forensic scientist can piece together broken pieces of glass from a bottle that was used as a weapon, it has:
a. individual characteristics b. class characteristics
c. identification characteristics d. comparative characteristics
Answers
If a forensic scientist can piece together broken pieces of glass from a bottle that was used as a weapon, it has individual characteristics.
Class features are defined as the properties of evidences which allow group comparison. It contains individual, class, identification, and comparative characteristics.
Individual characteristics is defined as the evidence which is associated with a common source with high certainty degree. The different evidences which are associated with individual characteristics are fingerprints, DNA, striations or pattern of lines on a bullet, glass, torn piece of cloth etc.
Class characteristics are associated with restricted group of people, which includes paint types, different blood groups of the people. Class characteristics are used to narrow down list of possible sources.
Therefore, if a forensic scientist can piece together broken pieces of glass from a bottle that was used as a weapon, it has individual characteristics. Hence, 'option a' is correct.
To know more about individual characteristics
https://brainly.com/question/13870990
#SPJ1
Answer: Individual characteristics
Explanation: The reason is that DNA, fingerprints, and blood type can be gained from the broken pieces of the broken glass bottle.
which form of energy does a cheeseburger have
Answers
Answer:
chemical potential energy - It mainly has chemical potential energy, this is really a type of electrical potential energy stored in the chemical bonds of the molecules
Explanation:
You can give the other person brainliest, I don't need it! :)
what happens when the graham crackers and rice krispie bar meet ?
Answers
Answer:
They make a rice Krispe gramcracker bar baby
Explanation:
Answer: When they meet they instantly fall in love, (lol) and have a baby.... They name the baby S'more because it has features from the graham cracker and the rice krispie.
Stay safe and have a Merry Christmas!!!!!!!! :D
Maybe a S'more rice krispie.....
How many moles of aluminum are in this aluminum can? Answer: ____________ (25 pts) Calculate the number of aluminum atoms in this can. Answer: _______________ (25 pts) The Amount of Aluminum is 12.69g
Answers
Answer:a)No of moles of Aluminium=0.4703
b)number of aluminum atoms=2.832 x 10^23 atoms
Explanation:
a)Given that The Amount/ Mass of Aluminum is 12.69g
We know that
No of moles =Mass/ Molar mass
Molar mass of Aluminium, Al is 26.982 g/mol
No of moles =12.69g/26.982 g/mol
No of moles =0.4703
Also
b) 1 mole of aluminium must contain 6.022 x 10^23 atoms of aluminium
which is known as Avogadro's constant.
Therefore, 0.4703 moles will contain 0.4703 x 6.022 x 10^23 atoms =2.832 x 10^23 atoms
if elements were combined by shaking would they have new properties
Answers
Answer: Yes because that's when they form a compound
Students place paper clips on a desk and then hold a magnet under the desk. What evidence would BEST show that the
magnetic field was able to pass through the desk?
O A The top of the desk is made of a kind of plastic.
OB. The paper clips move when the magnet is moved under the desk.
OC. The magnet they are using is the largest one in the classroom.
OD. The students were able to pick up these paper clips with a magnet.
Answers
Answer:
B
Explanation:
got it right on test
Answer:
Yes the correct answer is B
Explanation:
Have a good day!!!
A substance is a solid at room temperature, melts easily, conducts electricity weakly, and dissolves well in water and alcohol. What type of bonds does it have?
Answers
Answer:
Iconic bond
Explanation:
A form of chemical bond that included electrostatic attraction in the oppositely charged ions. It is one of the main types of bonding along with the covalent and metallic bonding. The substance is crystalline in nature since it melts easily and is solid at room temperature.I have made a thermometer which measures temperature by the
compressing and expanding of gas in a piston. I have measured that at
100° C the volume of the piston is 20 L. What is the temperature outside if
the piston has a volume of 15 L? What would be appropriate clothing for
the weather?
Answers
Environmental Effects Summary
Explain how the data from the river samples showed that there was a problem with the water treatment plant.
Answers
River samples may evidence problems with the water treatment plant because it may contain an excessive amount of certain substances which are filtered during this procedure.
What is a water treatment plant?A water treatment plant is a place where wastewater from a city is processed and purified in order to obtain potable water.
Water treatment procedure generally involves the collection, chemical substance addition, filtration, and disinfection.
Any type of problem in these steps can be evidenced by taking a sample of the water after treatment.
In conclusion, river samples evidence problems due to an excessive amount of certain substances which are filtered during this procedure.
Learn more about water treatment here:
https://brainly.com/question/13348717
#SPJ1
Arrange the following bonds in order of increasing ionic character:
C - H
F - H
Br - H
Na - Cl
K - F
Li - Cl
Answers
Answer:
This is the answer
C-H, Br-H, F-H, LI-CI, Na-CI, K-F
Hope this helps.